C20H31N3O2 — CID 119743435
4-[[(2S)-2-amino-4-methylpentanoyl]amino]-N-cyclohexyl-N-methylbenzamide (PubChem CID 119743435) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-[[(2S)-2-amino-4-methylpentanoyl]amino]-N-cyclohexyl-N-methylbenzamide.
| Compound Name | 4-[[(2S)-2-amino-4-methylpentanoyl]amino]-N-cyclohexyl-N-methylbenzamide |
|---|---|
| PubChem CID | 119743435 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 4-[[(2S)-2-amino-4-methylpentanoyl]amino]-N-cyclohexyl-N-methylbenzamide |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1ccc(C(=O)N(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H31N3O2/c1-14(2)13-18(21)19(24)22-16-11-9-15(10-12-16)20(25)23(3)17-7-5-4-6-8-17/h9-12,14,17-18H,4-8,13,21H2,1-3H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | JPJTUOAEPXAGES-SFHVURJKSA-N |
| XLogP | 3.40 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |