C16H26N4O2 — CID 119885345
(2S)-2-amino-N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-4-methylpentanamide (PubChem CID 119885345) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 119885345 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (2S)-2-amino-N-[4-[[2-(dimethylamino)acetyl]amino]phenyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1ccc(NC(=O)CN(C)C)cc1 |
| InChI | InChI=1S/C16H26N4O2/c1-11(2)9-14(17)16(22)19-13-7-5-12(6-8-13)18-15(21)10-20(3)4/h5-8,11,14H,9-10,17H2,1-4H3,(H,18,21)(H,19,22)/t14-/m0/s1 |
| InChIKey | MUSCWMDILIKNLB-AWEZNQCLSA-N |
| XLogP | 1.50 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |