About H-D-Leu-pna
H-D-Leu-pna (PubChem CID 7269396) has the molecular formula C12H17N3O3
and a molecular weight of 251.28 g/mol. Its IUPAC name is (2R)-2-amino-4-methyl-N-(4-nitrophenyl)pentanamide.
Molecular Properties
| Compound Name | H-D-Leu-pna |
| PubChem CID | 7269396 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2R)-2-amino-4-methyl-N-(4-nitrophenyl)pentanamide |
| SMILES | CC(C)C[C@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N |
| InChI | InChI=1S/C12H17N3O3/c1-8(2)7-11(13)12(16)14-9-3-5-10(6-4-9)15(17)18/h3-6,8,11H,7,13H2,1-2H3,(H,14,16)/t11-/m1/s1 |
| InChIKey | AXZJHDNQDSVIDR-LLVKDONJSA-N |
| XLogP | 1.70 |
| TPSA | 101.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 293 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze H-D-Leu-pna with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of H-D-Leu-pna?
The IUPAC name of H-D-Leu-pna (CID 7269396) is (2R)-2-amino-4-methyl-N-(4-nitrophenyl)pentanamide.
What is the SMILES notation for H-D-Leu-pna?
The canonical SMILES for H-D-Leu-pna is CC(C)C[C@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N.
What is the InChIKey of H-D-Leu-pna?
The InChIKey is AXZJHDNQDSVIDR-LLVKDONJSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-8(2)7-11(13)12(16)14-9-3-5-10(6-4-9)15(17)18/h3-6,8,11H,7,13H2,1-2H3,(H,14,16)/t11-/m1/s1.
What are the key properties of H-D-Leu-pna?
H-D-Leu-pna has a molecular weight of 251.28 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for H-D-Leu-pna is sourced from PubChem (CID 7269396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).