C14H20N4O3 — CID 56934013
(2S)-2-amino-4-methyl-N-[(E)-2-(4-nitrophenyl)ethylideneamino]pentanamide (PubChem CID 56934013) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[(E)-2-(4-nitrophenyl)ethylideneamino]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[(E)-2-(4-nitrophenyl)ethylideneamino]pentanamide |
|---|---|
| PubChem CID | 56934013 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[(E)-2-(4-nitrophenyl)ethylideneamino]pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N/N=C/Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20N4O3/c1-10(2)9-13(15)14(19)17-16-8-7-11-3-5-12(6-4-11)18(20)21/h3-6,8,10,13H,7,9,15H2,1-2H3,(H,17,19)/b16-8+/t13-/m0/s1 |
| InChIKey | BZDKVEFFJMTLFS-MJOIQJIUSA-N |
| XLogP | 1.61 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|