C10H11N3O5 — CID 22859396
(3S)-3-amino-4-(4-nitroanilino)-4-oxobutanoic acid (PubChem CID 22859396) has the molecular formula C10H11N3O5 and a molecular weight of 253.21 g/mol. Its IUPAC name is (3S)-3-amino-4-(4-nitroanilino)-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-(4-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22859396 |
| Molecular Formula | C10H11N3O5 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (3S)-3-amino-4-(4-nitroanilino)-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H11N3O5/c11-8(5-9(14)15)10(16)12-6-1-3-7(4-2-6)13(17)18/h1-4,8H,5,11H2,(H,12,16)(H,14,15)/t8-/m0/s1 |
| InChIKey | JPSVAMXHSUXSEY-QMMMGPOBSA-N |
| XLogP | 0.34 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|