C14H22N6O5 — CID 22811857
acetic acid;(2S)-2-amino-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide (PubChem CID 22811857) has the molecular formula C14H22N6O5 and a molecular weight of 354.37 g/mol. Its IUPAC name is acetic acid;(2S)-2-amino-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide.
| Compound Name | acetic acid;(2S)-2-amino-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide |
|---|---|
| PubChem CID | 22811857 |
| Molecular Formula | C14H22N6O5 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | acetic acid;(2S)-2-amino-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide |
| SMILES | CC(=O)O.NC(N)=NCCC[C@H](N)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H18N6O3.C2H4O2/c13-10(2-1-7-16-12(14)15)11(19)17-8-3-5-9(6-4-8)18(20)21;1-2(3)4/h3-6,10H,1-2,7,13H2,(H,17,19)(H4,14,15,16);1H3,(H,3,4)/t10-;/m0./s1 |
| InChIKey | QBFZKKFWBVFQSE-PPHPATTJSA-N |
| XLogP | 0.01 |
| TPSA | 199.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|