C23H28N8O8 — CID 54491190
benzyl N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]-nitroamino]-1-oxopropan-2-yl]carbamate (PubChem CID 54491190) has the molecular formula C23H28N8O8 and a molecular weight of 544.53 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]-nitroamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]-nitroamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54491190 |
| Molecular Formula | C23H28N8O8 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]-nitroamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)N([C@@H](CCCN=C(N)N)C(=O)Nc1ccc([N+](=O)[O-])cc1)[N+](=O)[O-] |
| InChI | InChI=1S/C23H28N8O8/c1-15(27-23(34)39-14-16-6-3-2-4-7-16)21(33)29(31(37)38)19(8-5-13-26-22(24)25)20(32)28-17-9-11-18(12-10-17)30(35)36/h2-4,6-7,9-12,15,19H,5,8,13-14H2,1H3,(H,27,34)(H,28,32)(H4,24,25,26)/t15-,19-/m0/s1 |
| InChIKey | XVVLTGNOPLOSMJ-KXBFYZLASA-N |
| XLogP | 1.29 |
| TPSA | 238.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|