C14H19N5O6 — CID 92977571
(2R)-5-(diaminomethylideneamino)-2-[nitro(phenylmethoxycarbonyl)amino]pentanoic acid (PubChem CID 92977571) has the molecular formula C14H19N5O6 and a molecular weight of 353.34 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[nitro(phenylmethoxycarbonyl)amino]pentanoic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[nitro(phenylmethoxycarbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 92977571 |
| Molecular Formula | C14H19N5O6 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[nitro(phenylmethoxycarbonyl)amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](C(=O)O)N(C(=O)OCc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N5O6/c15-13(16)17-8-4-7-11(12(20)21)18(19(23)24)14(22)25-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H,20,21)(H4,15,16,17)/t11-/m1/s1 |
| InChIKey | BMAOZVWPPFQHLT-LLVKDONJSA-N |
| XLogP | 0.32 |
| TPSA | 174.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|