C23H27N3O7 — CID 67631664
(2S)-2-[[(2S)-4-methyl-2-[nitro(phenylmethoxycarbonyl)amino]pentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 67631664) has the molecular formula C23H27N3O7 and a molecular weight of 457.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-methyl-2-[nitro(phenylmethoxycarbonyl)amino]pentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-4-methyl-2-[nitro(phenylmethoxycarbonyl)amino]pentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67631664 |
| Molecular Formula | C23H27N3O7 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (2S)-2-[[(2S)-4-methyl-2-[nitro(phenylmethoxycarbonyl)amino]pentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)O)N(C(=O)OCc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C23H27N3O7/c1-16(2)13-20(21(27)24-19(22(28)29)14-17-9-5-3-6-10-17)25(26(31)32)23(30)33-15-18-11-7-4-8-12-18/h3-12,16,19-20H,13-15H2,1-2H3,(H,24,27)(H,28,29)/t19-,20-/m0/s1 |
| InChIKey | LAMKAAFCBFBRHY-PMACEKPBSA-N |
| XLogP | 3.04 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|