C20H29N5O7 — CID 22804618
methyl 5-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-phenylmethoxypentan-2-yl]-nitroamino]-4-methyl-5-oxopentanoate (PubChem CID 22804618) has the molecular formula C20H29N5O7 and a molecular weight of 451.48 g/mol. Its IUPAC name is methyl 5-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-phenylmethoxypentan-2-yl]-nitroamino]-4-methyl-5-oxopentanoate.
| Compound Name | methyl 5-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-phenylmethoxypentan-2-yl]-nitroamino]-4-methyl-5-oxopentanoate |
|---|---|
| PubChem CID | 22804618 |
| Molecular Formula | C20H29N5O7 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | methyl 5-[[(2S)-5-(diaminomethylideneamino)-1-oxo-1-phenylmethoxypentan-2-yl]-nitroamino]-4-methyl-5-oxopentanoate |
| SMILES | COC(=O)CCC(C)C(=O)N([C@@H](CCCN=C(N)N)C(=O)OCc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C20H29N5O7/c1-14(10-11-17(26)31-2)18(27)24(25(29)30)16(9-6-12-23-20(21)22)19(28)32-13-15-7-4-3-5-8-15/h3-5,7-8,14,16H,6,9-13H2,1-2H3,(H4,21,22,23)/t14?,16-/m0/s1 |
| InChIKey | FHIMIWZHLJUHCG-WMCAAGNKSA-N |
| XLogP | 0.76 |
| TPSA | 180.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|