C22H28N4O4 — CID 10573727
benzyl (2R)-2-[[(2R)-5-(diaminomethylideneamino)-2-hydroxypentanoyl]amino]-3-phenylpropanoate (PubChem CID 10573727) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is benzyl (2R)-2-[[(2R)-5-(diaminomethylideneamino)-2-hydroxypentanoyl]amino]-3-phenylpropanoate.
| Compound Name | benzyl (2R)-2-[[(2R)-5-(diaminomethylideneamino)-2-hydroxypentanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10573727 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | benzyl (2R)-2-[[(2R)-5-(diaminomethylideneamino)-2-hydroxypentanoyl]amino]-3-phenylpropanoate |
| SMILES | NC(N)=NCCC[C@@H](O)C(=O)N[C@H](Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H28N4O4/c23-22(24)25-13-7-12-19(27)20(28)26-18(14-16-8-3-1-4-9-16)21(29)30-15-17-10-5-2-6-11-17/h1-6,8-11,18-19,27H,7,12-15H2,(H,26,28)(H4,23,24,25)/t18-,19-/m1/s1 |
| InChIKey | CQLYCHASYXJBKJ-RTBURBONSA-N |
| XLogP | 0.87 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|