C24H33N7O3 — CID 89117809
(2S)-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide (PubChem CID 89117809) has the molecular formula C24H33N7O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is (2S)-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 89117809 |
| Molecular Formula | C24H33N7O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | (2S)-N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(=O)C(Cc1ccccc1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C24H33N7O3/c25-18(14-16-8-3-1-4-9-16)22(33)30-19(12-7-13-29-24(27)28)23(34)31-20(21(26)32)15-17-10-5-2-6-11-17/h1-6,8-11,18-20H,7,12-15,25H2,(H2,26,32)(H,30,33)(H,31,34)(H4,27,28,29)/t18-,19-,20?/m0/s1 |
| InChIKey | KDEZHJVGUZIVDI-NFBCFJMWSA-N |
| XLogP | -0.69 |
| TPSA | 191.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|