C27H46N8O4 — CID 10415062
(2S)-N-[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide (PubChem CID 10415062) has the molecular formula C27H46N8O4 and a molecular weight of 546.72 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 10415062 |
| Molecular Formula | C27H46N8O4 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | (2S)-N-[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C27H46N8O4/c1-16(2)13-21(34-24(37)19(28)15-18-9-6-5-7-10-18)26(39)35-22(14-17(3)4)25(38)33-20(23(29)36)11-8-12-32-27(30)31/h5-7,9-10,16-17,19-22H,8,11-15,28H2,1-4H3,(H2,29,36)(H,33,38)(H,34,37)(H,35,39)(H4,30,31,32)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | XYPLCUKJTSGWBA-CMOCDZPBSA-N |
| XLogP | -0.36 |
| TPSA | 220.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|