C26H34N6O6 — CID 175015537
dibenzyl 2-[[2,4-diamino-7-(diaminomethylideneamino)-3-oxoheptanoyl]amino]butanedioate (PubChem CID 175015537) has the molecular formula C26H34N6O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is dibenzyl 2-[[2,4-diamino-7-(diaminomethylideneamino)-3-oxoheptanoyl]amino]butanedioate.
| Compound Name | dibenzyl 2-[[2,4-diamino-7-(diaminomethylideneamino)-3-oxoheptanoyl]amino]butanedioate |
|---|---|
| PubChem CID | 175015537 |
| Molecular Formula | C26H34N6O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | dibenzyl 2-[[2,4-diamino-7-(diaminomethylideneamino)-3-oxoheptanoyl]amino]butanedioate |
| SMILES | NC(N)=NCCCC(N)C(=O)C(N)C(=O)NC(CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H34N6O6/c27-19(12-7-13-31-26(29)30)23(34)22(28)24(35)32-20(25(36)38-16-18-10-5-2-6-11-18)14-21(33)37-15-17-8-3-1-4-9-17/h1-6,8-11,19-20,22H,7,12-16,27-28H2,(H,32,35)(H4,29,30,31) |
| InChIKey | ZEPDDYLINYBLSH-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 215.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|