C31H54N8O4 — CID 10817429
benzyl 4,4-bis[9-(diaminomethylideneamino)nonanoylamino]butanoate (PubChem CID 10817429) has the molecular formula C31H54N8O4 and a molecular weight of 602.83 g/mol. Its IUPAC name is benzyl 4,4-bis[9-(diaminomethylideneamino)nonanoylamino]butanoate.
| Compound Name | benzyl 4,4-bis[9-(diaminomethylideneamino)nonanoylamino]butanoate |
|---|---|
| PubChem CID | 10817429 |
| Molecular Formula | C31H54N8O4 |
| Molecular Weight | 602.83 g/mol |
| Exact Mass | 602.43 |
| IUPAC Name | benzyl 4,4-bis[9-(diaminomethylideneamino)nonanoylamino]butanoate |
| SMILES | NC(N)=NCCCCCCCCC(=O)NC(CCC(=O)OCc1ccccc1)NC(=O)CCCCCCCCN=C(N)N |
| InChI | InChI=1S/C31H54N8O4/c32-30(33)36-22-14-7-3-1-5-12-18-27(40)38-26(20-21-29(42)43-24-25-16-10-9-11-17-25)39-28(41)19-13-6-2-4-8-15-23-37-31(34)35/h9-11,16-17,26H,1-8,12-15,18-24H2,(H,38,40)(H,39,41)(H4,32,33,36)(H4,34,35,37) |
| InChIKey | YSMFNUMSXTYVQD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 213.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.83 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|