C26H43N5O5 — CID 139479730
methyl (4S)-7-(diaminomethylideneamino)-4-[[(2S)-3-(4-hydroxyphenyl)-2-(octanoylamino)propanoyl]amino]heptanoate (PubChem CID 139479730) has the molecular formula C26H43N5O5 and a molecular weight of 505.66 g/mol. Its IUPAC name is methyl (4S)-7-(diaminomethylideneamino)-4-[[(2S)-3-(4-hydroxyphenyl)-2-(octanoylamino)propanoyl]amino]heptanoate.
| Compound Name | methyl (4S)-7-(diaminomethylideneamino)-4-[[(2S)-3-(4-hydroxyphenyl)-2-(octanoylamino)propanoyl]amino]heptanoate |
|---|---|
| PubChem CID | 139479730 |
| Molecular Formula | C26H43N5O5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | methyl (4S)-7-(diaminomethylideneamino)-4-[[(2S)-3-(4-hydroxyphenyl)-2-(octanoylamino)propanoyl]amino]heptanoate |
| SMILES | CCCCCCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)CCC(=O)OC |
| InChI | InChI=1S/C26H43N5O5/c1-3-4-5-6-7-10-23(33)31-22(18-19-11-14-21(32)15-12-19)25(35)30-20(13-16-24(34)36-2)9-8-17-29-26(27)28/h11-12,14-15,20,22,32H,3-10,13,16-18H2,1-2H3,(H,30,35)(H,31,33)(H4,27,28,29)/t20-,22-/m0/s1 |
| InChIKey | SSULRIWULWPFOD-UNMCSNQZSA-N |
| XLogP | 2.27 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|