C33H57N5O5 — CID 46833137
hexadecan-7-yl (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate (PubChem CID 46833137) has the molecular formula C33H57N5O5 and a molecular weight of 603.85 g/mol. Its IUPAC name is hexadecan-7-yl (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate.
| Compound Name | hexadecan-7-yl (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 46833137 |
| Molecular Formula | C33H57N5O5 |
| Molecular Weight | 603.85 g/mol |
| Exact Mass | 603.44 |
| IUPAC Name | hexadecan-7-yl (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate |
| SMILES | CCCCCCCCCC(CCCCCC)OC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O |
| InChI | InChI=1S/C33H57N5O5/c1-4-6-8-10-11-12-14-17-28(16-13-9-7-5-2)43-32(42)29(18-15-23-36-33(34)35)38-31(41)30(37-25(3)39)24-26-19-21-27(40)22-20-26/h19-22,28-30,40H,4-18,23-24H2,1-3H3,(H,37,39)(H,38,41)(H4,34,35,36)/t28?,29-,30-/m0/s1 |
| InChIKey | QUZJNFSADPQABY-WYMOGZRNSA-N |
| XLogP | 5.00 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.85 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|