C26H41N5O5 — CID 153339935
3-[(2R)-2-[2-(diaminomethylideneamino)ethyl]-1-[[(2S)-3-(4-hydroxyphenyl)-2-(octanoylamino)propanoyl]amino]cyclopropyl]propanoic acid (PubChem CID 153339935) has the molecular formula C26H41N5O5 and a molecular weight of 503.64 g/mol. Its IUPAC name is 3-[(2R)-2-[2-(diaminomethylideneamino)ethyl]-1-[[(2S)-3-(4-hydroxyphenyl)-2-(octanoylamino)propanoyl]amino]cyclopropyl]propanoic acid.
| Compound Name | 3-[(2R)-2-[2-(diaminomethylideneamino)ethyl]-1-[[(2S)-3-(4-hydroxyphenyl)-2-(octanoylamino)propanoyl]amino]cyclopropyl]propanoic acid |
|---|---|
| PubChem CID | 153339935 |
| Molecular Formula | C26H41N5O5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | 3-[(2R)-2-[2-(diaminomethylideneamino)ethyl]-1-[[(2S)-3-(4-hydroxyphenyl)-2-(octanoylamino)propanoyl]amino]cyclopropyl]propanoic acid |
| SMILES | CCCCCCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NC1(CCC(=O)O)C[C@H]1CCN=C(N)N |
| InChI | InChI=1S/C26H41N5O5/c1-2-3-4-5-6-7-22(33)30-21(16-18-8-10-20(32)11-9-18)24(36)31-26(14-12-23(34)35)17-19(26)13-15-29-25(27)28/h8-11,19,21,32H,2-7,12-17H2,1H3,(H,30,33)(H,31,36)(H,34,35)(H4,27,28,29)/t19-,21+,26?/m1/s1 |
| InChIKey | PMWPFQUOJYZZIE-AYIPWPNJSA-N |
| XLogP | 2.18 |
| TPSA | 180.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|