C37H66F3N9O6 — CID 22210486
N-[1-[3-[4-[3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]butylamino]propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]decanamide;2,2,2-trifluoroacetic acid (PubChem CID 22210486) has the molecular formula C37H66F3N9O6 and a molecular weight of 789.99 g/mol. Its IUPAC name is N-[1-[3-[4-[3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]butylamino]propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]decanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[1-[3-[4-[3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]butylamino]propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]decanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22210486 |
| Molecular Formula | C37H66F3N9O6 |
| Molecular Weight | 789.99 g/mol |
| Exact Mass | 789.51 |
| IUPAC Name | N-[1-[3-[4-[3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]butylamino]propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]decanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCCCC(=O)NC(Cc1ccc(O)cc1)C(=O)NCCCNCCCCNCCCNC(=O)C(N)CCCN=C(N)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C35H65N9O4.C2HF3O2/c1-2-3-4-5-6-7-8-15-32(46)44-31(27-28-16-18-29(45)19-17-28)34(48)42-26-13-23-40-21-10-9-20-39-22-12-25-41-33(47)30(36)14-11-24-43-35(37)38;3-2(4,5)1(6)7/h16-19,30-31,39-40,45H,2-15,20-27,36H2,1H3,(H,41,47)(H,42,48)(H,44,46)(H4,37,38,43);(H,6,7) |
| InChIKey | SSOBMZWYNDAKPM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 259.31 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.99 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|