C35H57N9O4 — CID 20642657
2-amino-5-(diaminomethylideneamino)-N-[3-[3-[5-[[2-[[2-(2-methoxyphenyl)acetyl]amino]-3-phenylpropanoyl]amino]pentylamino]propylamino]propyl]pentanamide (PubChem CID 20642657) has the molecular formula C35H57N9O4 and a molecular weight of 667.90 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)-N-[3-[3-[5-[[2-[[2-(2-methoxyphenyl)acetyl]amino]-3-phenylpropanoyl]amino]pentylamino]propylamino]propyl]pentanamide.
| Compound Name | 2-amino-5-(diaminomethylideneamino)-N-[3-[3-[5-[[2-[[2-(2-methoxyphenyl)acetyl]amino]-3-phenylpropanoyl]amino]pentylamino]propylamino]propyl]pentanamide |
|---|---|
| PubChem CID | 20642657 |
| Molecular Formula | C35H57N9O4 |
| Molecular Weight | 667.90 g/mol |
| Exact Mass | 667.45 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)-N-[3-[3-[5-[[2-[[2-(2-methoxyphenyl)acetyl]amino]-3-phenylpropanoyl]amino]pentylamino]propylamino]propyl]pentanamide |
| SMILES | COc1ccccc1CC(=O)NC(Cc1ccccc1)C(=O)NCCCCCNCCCNCCCNC(=O)C(N)CCCN=C(N)N |
| InChI | InChI=1S/C35H57N9O4/c1-48-31-17-7-6-15-28(31)26-32(45)44-30(25-27-13-4-2-5-14-27)34(47)42-22-9-3-8-18-39-19-11-20-40-21-12-24-41-33(46)29(36)16-10-23-43-35(37)38/h2,4-7,13-15,17,29-30,39-40H,3,8-12,16,18-26,36H2,1H3,(H,41,46)(H,42,47)(H,44,45)(H4,37,38,43) |
| InChIKey | CUYVFIURMHTJRP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 211.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.90 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|