C23H35N7O7 — CID 71500402
(3S)-3-[4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butanoylamino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid (PubChem CID 71500402) has the molecular formula C23H35N7O7 and a molecular weight of 521.58 g/mol. Its IUPAC name is (3S)-3-[4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butanoylamino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butanoylamino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71500402 |
| Molecular Formula | C23H35N7O7 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | (3S)-3-[4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butanoylamino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)NCCCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H35N7O7/c24-15(8-4-11-28-23(25)26)20(34)27-10-5-9-18(31)29-16(13-19(32)33)21(35)30-17(22(36)37)12-14-6-2-1-3-7-14/h1-3,6-7,15-17H,4-5,8-13,24H2,(H,27,34)(H,29,31)(H,30,35)(H,32,33)(H,36,37)(H4,25,26,28)/t15-,16-,17-/m0/s1 |
| InChIKey | NPGXZNWENMGPOB-ULQDDVLXSA-N |
| XLogP | -1.96 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|