C23H32FN7O7 — CID 71500057
(3S)-3-[[(Z)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-2-fluorobut-2-enoyl]amino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid (PubChem CID 71500057) has the molecular formula C23H32FN7O7 and a molecular weight of 537.55 g/mol. Its IUPAC name is (3S)-3-[[(Z)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-2-fluorobut-2-enoyl]amino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(Z)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-2-fluorobut-2-enoyl]amino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71500057 |
| Molecular Formula | C23H32FN7O7 |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | (3S)-3-[[(Z)-4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-2-fluorobut-2-enoyl]amino]-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)NC/C=C(\F)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H32FN7O7/c24-14(8-10-28-20(35)15(25)7-4-9-29-23(26)27)19(34)30-16(12-18(32)33)21(36)31-17(22(37)38)11-13-5-2-1-3-6-13/h1-3,5-6,8,15-17H,4,7,9-12,25H2,(H,28,35)(H,30,34)(H,31,36)(H,32,33)(H,37,38)(H4,26,27,29)/b14-8-/t15-,16-,17-/m0/s1 |
| InChIKey | RTSGVCSBUQIWRN-DYCFVZSFSA-N |
| XLogP | -1.89 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|