C20H31N7O6 — CID 175735254
(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 175735254) has the molecular formula C20H31N7O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 175735254 |
| Molecular Formula | C20H31N7O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C20H31N7O6/c21-13(7-4-8-24-20(22)23)17(30)25-10-16(29)26-14(9-12-5-2-1-3-6-12)18(31)27-15(11-28)19(32)33/h1-3,5-6,13-15,28H,4,7-11,21H2,(H,25,30)(H,26,29)(H,27,31)(H,32,33)(H4,22,23,24)/t13-,14-,15-/m0/s1 |
| InChIKey | OVWCIHCVIGLDRG-KKUMJFAQSA-N |
| XLogP | -3.23 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|