C20H31N7O5S — CID 18242261
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 18242261) has the molecular formula C20H31N7O5S and a molecular weight of 481.58 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18242261 |
| Molecular Formula | C20H31N7O5S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CS)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H31N7O5S/c21-13(7-4-8-24-20(22)23)17(29)27-15(11-33)18(30)25-10-16(28)26-14(19(31)32)9-12-5-2-1-3-6-12/h1-3,5-6,13-15,33H,4,7-11,21H2,(H,25,30)(H,26,28)(H,27,29)(H,31,32)(H4,22,23,24) |
| InChIKey | GOCZMORSXKNQSP-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|