C20H32N8O4S — CID 175908134
(2S)-2-amino-N-[(2S)-1-[[(2R)-1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 175908134) has the molecular formula C20H32N8O4S and a molecular weight of 480.60 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-1-[[(2R)-1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-1-[[(2R)-1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 175908134 |
| Molecular Formula | C20H32N8O4S |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-1-[[(2R)-1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(=O)CNC(=O)[C@H](CS)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C20H32N8O4S/c21-13(7-4-8-25-20(23)24)17(30)27-14(9-12-5-2-1-3-6-12)19(32)28-15(11-33)18(31)26-10-16(22)29/h1-3,5-6,13-15,33H,4,7-11,21H2,(H2,22,29)(H,26,31)(H,27,30)(H,28,32)(H4,23,24,25)/t13-,14-,15-/m0/s1 |
| InChIKey | INWDBJIIAASUNV-KKUMJFAQSA-N |
| XLogP | -2.89 |
| TPSA | 220.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|