C29H51N9O6 — CID 20642659
2-amino-5-(diaminomethylideneamino)-N-[3-[3-[5-[[2-[[2-(2,4-dihydroxyphenyl)acetyl]amino]-4-oxobutanoyl]amino]pentylamino]propylamino]propyl]pentanamide (PubChem CID 20642659) has the molecular formula C29H51N9O6 and a molecular weight of 621.78 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)-N-[3-[3-[5-[[2-[[2-(2,4-dihydroxyphenyl)acetyl]amino]-4-oxobutanoyl]amino]pentylamino]propylamino]propyl]pentanamide.
| Compound Name | 2-amino-5-(diaminomethylideneamino)-N-[3-[3-[5-[[2-[[2-(2,4-dihydroxyphenyl)acetyl]amino]-4-oxobutanoyl]amino]pentylamino]propylamino]propyl]pentanamide |
|---|---|
| PubChem CID | 20642659 |
| Molecular Formula | C29H51N9O6 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.40 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)-N-[3-[3-[5-[[2-[[2-(2,4-dihydroxyphenyl)acetyl]amino]-4-oxobutanoyl]amino]pentylamino]propylamino]propyl]pentanamide |
| SMILES | NC(N)=NCCCC(N)C(=O)NCCCNCCCNCCCCCNC(=O)C(CC=O)NC(=O)Cc1ccc(O)cc1O |
| InChI | InChI=1S/C29H51N9O6/c30-23(7-4-16-37-29(31)32)27(43)35-17-6-14-34-13-5-12-33-11-2-1-3-15-36-28(44)24(10-18-39)38-26(42)19-21-8-9-22(40)20-25(21)41/h8-9,18,20,23-24,33-34,40-41H,1-7,10-17,19,30H2,(H,35,43)(H,36,44)(H,38,42)(H4,31,32,37) |
| InChIKey | PBSYVCNCNSLMRJ-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 259.31 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|