C27H48N8O5 — CID 71716135
(2R)-2-amino-4-(diaminomethylideneamino)-N-[8-[4-[[2-[[2-(2,4-dihydroxyphenyl)acetyl]amino]acetyl]amino]butylamino]octyl]butanamide (PubChem CID 71716135) has the molecular formula C27H48N8O5 and a molecular weight of 564.73 g/mol. Its IUPAC name is (2R)-2-amino-4-(diaminomethylideneamino)-N-[8-[4-[[2-[[2-(2,4-dihydroxyphenyl)acetyl]amino]acetyl]amino]butylamino]octyl]butanamide.
| Compound Name | (2R)-2-amino-4-(diaminomethylideneamino)-N-[8-[4-[[2-[[2-(2,4-dihydroxyphenyl)acetyl]amino]acetyl]amino]butylamino]octyl]butanamide |
|---|---|
| PubChem CID | 71716135 |
| Molecular Formula | C27H48N8O5 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.37 |
| IUPAC Name | (2R)-2-amino-4-(diaminomethylideneamino)-N-[8-[4-[[2-[[2-(2,4-dihydroxyphenyl)acetyl]amino]acetyl]amino]butylamino]octyl]butanamide |
| SMILES | NC(N)=NCC[C@@H](N)C(=O)NCCCCCCCCNCCCCNC(=O)CNC(=O)Cc1ccc(O)cc1O |
| InChI | InChI=1S/C27H48N8O5/c28-22(11-16-34-27(29)30)26(40)33-15-6-4-2-1-3-5-12-31-13-7-8-14-32-25(39)19-35-24(38)17-20-9-10-21(36)18-23(20)37/h9-10,18,22,31,36-37H,1-8,11-17,19,28H2,(H,32,39)(H,33,40)(H,35,38)(H4,29,30,34)/t22-/m1/s1 |
| InChIKey | MSZPDQXDEPKPTE-JOCHJYFZSA-N |
| XLogP | -0.31 |
| TPSA | 230.21 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|