C30H54N10O5 — CID 20642766
N-[5-[3-[3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]propylamino]pentyl]-2-[[2-(2-methoxyphenyl)acetyl]amino]butanediamide (PubChem CID 20642766) has the molecular formula C30H54N10O5 and a molecular weight of 634.83 g/mol. Its IUPAC name is N-[5-[3-[3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]propylamino]pentyl]-2-[[2-(2-methoxyphenyl)acetyl]amino]butanediamide.
| Compound Name | N-[5-[3-[3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]propylamino]pentyl]-2-[[2-(2-methoxyphenyl)acetyl]amino]butanediamide |
|---|---|
| PubChem CID | 20642766 |
| Molecular Formula | C30H54N10O5 |
| Molecular Weight | 634.83 g/mol |
| Exact Mass | 634.43 |
| IUPAC Name | N-[5-[3-[3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]propylamino]pentyl]-2-[[2-(2-methoxyphenyl)acetyl]amino]butanediamide |
| SMILES | COc1ccccc1CC(=O)NC(CC(N)=O)C(=O)NCCCCCNCCCNCCCNC(=O)C(N)CCCN=C(N)N |
| InChI | InChI=1S/C30H54N10O5/c1-45-25-12-4-3-10-22(25)20-27(42)40-24(21-26(32)41)29(44)38-17-6-2-5-13-35-14-8-15-36-16-9-19-37-28(43)23(31)11-7-18-39-30(33)34/h3-4,10,12,23-24,35-36H,2,5-9,11,13-21,31H2,1H3,(H2,32,41)(H,37,43)(H,38,44)(H,40,42)(H4,33,34,39) |
| InChIKey | DXSHTBOGFNPDSR-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 254.10 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.83 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|