C36H58N8O4 — CID 20697044
2-amino-5-(1-aminoethylideneamino)-N-[3-[3-[5-[[2-[[2-(2-methoxyphenyl)acetyl]amino]-3-phenylpropanoyl]amino]pentylamino]propylamino]propyl]pentanamide (PubChem CID 20697044) has the molecular formula C36H58N8O4 and a molecular weight of 666.91 g/mol. Its IUPAC name is 2-amino-5-(1-aminoethylideneamino)-N-[3-[3-[5-[[2-[[2-(2-methoxyphenyl)acetyl]amino]-3-phenylpropanoyl]amino]pentylamino]propylamino]propyl]pentanamide.
| Compound Name | 2-amino-5-(1-aminoethylideneamino)-N-[3-[3-[5-[[2-[[2-(2-methoxyphenyl)acetyl]amino]-3-phenylpropanoyl]amino]pentylamino]propylamino]propyl]pentanamide |
|---|---|
| PubChem CID | 20697044 |
| Molecular Formula | C36H58N8O4 |
| Molecular Weight | 666.91 g/mol |
| Exact Mass | 666.46 |
| IUPAC Name | 2-amino-5-(1-aminoethylideneamino)-N-[3-[3-[5-[[2-[[2-(2-methoxyphenyl)acetyl]amino]-3-phenylpropanoyl]amino]pentylamino]propylamino]propyl]pentanamide |
| SMILES | COc1ccccc1CC(=O)NC(Cc1ccccc1)C(=O)NCCCCCNCCCNCCCNC(=O)C(N)CCC/N=C(\C)N |
| InChI | InChI=1S/C36H58N8O4/c1-28(37)41-24-11-17-31(38)35(46)42-25-13-22-40-21-12-20-39-19-9-4-10-23-43-36(47)32(26-29-14-5-3-6-15-29)44-34(45)27-30-16-7-8-18-33(30)48-2/h3,5-8,14-16,18,31-32,39-40H,4,9-13,17,19-27,38H2,1-2H3,(H2,37,41)(H,42,46)(H,43,47)(H,44,45) |
| InChIKey | FUWNZFQVDPGNIC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 184.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.91 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|