C24H52N10O4 — CID 54604077
acetic acid;2-amino-N-[10-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]decyl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 54604077) has the molecular formula C24H52N10O4 and a molecular weight of 544.75 g/mol. Its IUPAC name is acetic acid;2-amino-N-[10-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]decyl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | acetic acid;2-amino-N-[10-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]decyl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 54604077 |
| Molecular Formula | C24H52N10O4 |
| Molecular Weight | 544.75 g/mol |
| Exact Mass | 544.42 |
| IUPAC Name | acetic acid;2-amino-N-[10-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]decyl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | CC(=O)O.NC(N)=NCCCC(N)C(=O)NCCCCCCCCCCNC(=O)C(N)CCCN=C(N)N |
| InChI | InChI=1S/C22H48N10O2.C2H4O2/c23-17(11-9-15-31-21(25)26)19(33)29-13-7-5-3-1-2-4-6-8-14-30-20(34)18(24)12-10-16-32-22(27)28;1-2(3)4/h17-18H,1-16,23-24H2,(H,29,33)(H,30,34)(H4,25,26,31)(H4,27,28,32);1H3,(H,3,4) |
| InChIKey | LXSSTGCRZGKMHF-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 276.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.75 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|