C13H29N7O2 — CID 141439784
(2S)-2-amino-6-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]hexanamide (PubChem CID 141439784) has the molecular formula C13H29N7O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (2S)-2-amino-6-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]hexanamide.
| Compound Name | (2S)-2-amino-6-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 141439784 |
| Molecular Formula | C13H29N7O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | (2S)-2-amino-6-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]hexanamide |
| SMILES | NC(=O)[C@@H](N)CCCCNC(=O)[C@@H](N)CCCCN=C(N)N |
| InChI | InChI=1S/C13H29N7O2/c14-9(11(16)21)5-1-3-7-19-12(22)10(15)6-2-4-8-20-13(17)18/h9-10H,1-8,14-15H2,(H2,16,21)(H,19,22)(H4,17,18,20)/t9-,10-/m0/s1 |
| InChIKey | UOAQIQGYHYNBGP-UWVGGRQHSA-N |
| XLogP | -2.14 |
| TPSA | 188.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|