C7H17N7O2 — CID 54323460
[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]urea (PubChem CID 54323460) has the molecular formula C7H17N7O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is [[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]urea.
| Compound Name | [[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]urea |
|---|---|
| PubChem CID | 54323460 |
| Molecular Formula | C7H17N7O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | [[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]urea |
| SMILES | NC(=O)NNC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C7H17N7O2/c8-4(2-1-3-12-6(9)10)5(15)13-14-7(11)16/h4H,1-3,8H2,(H,13,15)(H4,9,10,12)(H3,11,14,16)/t4-/m0/s1 |
| InChIKey | STGMYIULJGRITP-BYPYZUCNSA-N |
| XLogP | -2.93 |
| TPSA | 174.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|