C10H22ClN5O — CID 90457141
2-amino-5-(diaminomethylideneamino)-N-(2-methylprop-2-enyl)pentanamide;hydron;chloride (PubChem CID 90457141) has the molecular formula C10H22ClN5O and a molecular weight of 263.77 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)-N-(2-methylprop-2-enyl)pentanamide;hydron;chloride.
| Compound Name | 2-amino-5-(diaminomethylideneamino)-N-(2-methylprop-2-enyl)pentanamide;hydron;chloride |
|---|---|
| PubChem CID | 90457141 |
| Molecular Formula | C10H22ClN5O |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)-N-(2-methylprop-2-enyl)pentanamide;hydron;chloride |
| SMILES | C=C(C)CNC(=O)C(N)CCCN=C(N)N.[Cl-].[H+] |
| InChI | InChI=1S/C10H21N5O.ClH/c1-7(2)6-15-9(16)8(11)4-3-5-14-10(12)13;/h8H,1,3-6,11H2,2H3,(H,15,16)(H4,12,13,14);1H |
| InChIKey | LXPGWCDTWQRAAJ-UHFFFAOYSA-N |
| XLogP | -3.82 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|