C13H29N5O — CID 155310394
2-amino-6-(diaminomethylideneamino)-N-(3-methylpentyl)hexanamide (PubChem CID 155310394) has the molecular formula C13H29N5O and a molecular weight of 271.41 g/mol. Its IUPAC name is 2-amino-6-(diaminomethylideneamino)-N-(3-methylpentyl)hexanamide.
| Compound Name | 2-amino-6-(diaminomethylideneamino)-N-(3-methylpentyl)hexanamide |
|---|---|
| PubChem CID | 155310394 |
| Molecular Formula | C13H29N5O |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.24 |
| IUPAC Name | 2-amino-6-(diaminomethylideneamino)-N-(3-methylpentyl)hexanamide |
| SMILES | CCC(C)CCNC(=O)C(N)CCCCN=C(N)N |
| InChI | InChI=1S/C13H29N5O/c1-3-10(2)7-9-17-12(19)11(14)6-4-5-8-18-13(15)16/h10-11H,3-9,14H2,1-2H3,(H,17,19)(H4,15,16,18) |
| InChIKey | MQHKTQCMBUHPAJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|