C12H28N5O2P — CID 178063021
2-amino-5-(diaminomethylideneamino)-N-(2-oxo-2-phosphanylethyl)pentanamide;2-methylpropane (PubChem CID 178063021) has the molecular formula C12H28N5O2P and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)-N-(2-oxo-2-phosphanylethyl)pentanamide;2-methylpropane.
| Compound Name | 2-amino-5-(diaminomethylideneamino)-N-(2-oxo-2-phosphanylethyl)pentanamide;2-methylpropane |
|---|---|
| PubChem CID | 178063021 |
| Molecular Formula | C12H28N5O2P |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)-N-(2-oxo-2-phosphanylethyl)pentanamide;2-methylpropane |
| SMILES | CC(C)C.NC(N)=NCCCC(N)C(=O)NCC(=O)P |
| InChI | InChI=1S/C8H18N5O2P.C4H10/c9-5(2-1-3-12-8(10)11)7(15)13-4-6(14)16;1-4(2)3/h5H,1-4,9,16H2,(H,13,15)(H4,10,11,12);4H,1-3H3 |
| InChIKey | FHQFDZFSAIMWBC-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|