C9H20N4O — CID 59360329
N-[3-(diaminomethylideneamino)propyl]-2-methylbutanamide (PubChem CID 59360329) has the molecular formula C9H20N4O and a molecular weight of 200.29 g/mol. Its IUPAC name is N-[3-(diaminomethylideneamino)propyl]-2-methylbutanamide.
| Compound Name | N-[3-(diaminomethylideneamino)propyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 59360329 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | N-[3-(diaminomethylideneamino)propyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)NCCCN=C(N)N |
| InChI | InChI=1S/C9H20N4O/c1-3-7(2)8(14)12-5-4-6-13-9(10)11/h7H,3-6H2,1-2H3,(H,12,14)(H4,10,11,13) |
| InChIKey | QSLQMKUDLJGJAE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|