C9H20IN5O — CID 146429799
N-(3-aminopropyl)-5-(diaminomethylideneamino)-2-iodopentanamide (PubChem CID 146429799) has the molecular formula C9H20IN5O and a molecular weight of 341.20 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-(diaminomethylideneamino)-2-iodopentanamide.
| Compound Name | N-(3-aminopropyl)-5-(diaminomethylideneamino)-2-iodopentanamide |
|---|---|
| PubChem CID | 146429799 |
| Molecular Formula | C9H20IN5O |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-(3-aminopropyl)-5-(diaminomethylideneamino)-2-iodopentanamide |
| SMILES | NCCCNC(=O)C(I)CCCN=C(N)N |
| InChI | InChI=1S/C9H20IN5O/c10-7(3-1-5-15-9(12)13)8(16)14-6-2-4-11/h7H,1-6,11H2,(H,14,16)(H4,12,13,15) |
| InChIKey | XEBFXANGUMWKRC-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|