C18H39N7O3 — CID 14801245
N-[3-[4-(3-aminopropylamino)butylamino]-2-hydroxy-3-oxopropyl]-7-(diaminomethylideneamino)heptanamide (PubChem CID 14801245) has the molecular formula C18H39N7O3 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-[3-[4-(3-aminopropylamino)butylamino]-2-hydroxy-3-oxopropyl]-7-(diaminomethylideneamino)heptanamide.
| Compound Name | N-[3-[4-(3-aminopropylamino)butylamino]-2-hydroxy-3-oxopropyl]-7-(diaminomethylideneamino)heptanamide |
|---|---|
| PubChem CID | 14801245 |
| Molecular Formula | C18H39N7O3 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | N-[3-[4-(3-aminopropylamino)butylamino]-2-hydroxy-3-oxopropyl]-7-(diaminomethylideneamino)heptanamide |
| SMILES | NCCCNCCCCNC(=O)C(O)CNC(=O)CCCCCCN=C(N)N |
| InChI | InChI=1S/C18H39N7O3/c19-9-7-11-22-10-5-6-12-23-17(28)15(26)14-25-16(27)8-3-1-2-4-13-24-18(20)21/h15,22,26H,1-14,19H2,(H,23,28)(H,25,27)(H4,20,21,24) |
| InChIKey | GGDLNDSKDFNDRW-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 180.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|