C17H39N7O2 — CID 54585484
N-[(1S)-2-[4-(3-aminopropylamino)butylamino]-1-hydroxyethyl]-7-(diaminomethylideneamino)heptanamide (PubChem CID 54585484) has the molecular formula C17H39N7O2 and a molecular weight of 373.55 g/mol. Its IUPAC name is N-[(1S)-2-[4-(3-aminopropylamino)butylamino]-1-hydroxyethyl]-7-(diaminomethylideneamino)heptanamide.
| Compound Name | N-[(1S)-2-[4-(3-aminopropylamino)butylamino]-1-hydroxyethyl]-7-(diaminomethylideneamino)heptanamide |
|---|---|
| PubChem CID | 54585484 |
| Molecular Formula | C17H39N7O2 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.32 |
| IUPAC Name | N-[(1S)-2-[4-(3-aminopropylamino)butylamino]-1-hydroxyethyl]-7-(diaminomethylideneamino)heptanamide |
| SMILES | NCCCNCCCCNC[C@H](O)NC(=O)CCCCCCN=C(N)N |
| InChI | InChI=1S/C17H39N7O2/c18-9-7-12-21-10-5-6-11-22-14-16(26)24-15(25)8-3-1-2-4-13-23-17(19)20/h16,21-22,26H,1-14,18H2,(H,24,25)(H4,19,20,23)/t16-/m0/s1 |
| InChIKey | BLUYEPLOXLPVCJ-INIZCTEOSA-N |
| XLogP | -1.05 |
| TPSA | 163.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|