C19H41N7O4 — CID 10526684
N-[4-(3-aminopropylamino)butyl]-N'-[6-(diaminomethylideneamino)hexyl]-2,2-bis(hydroxymethyl)propanediamide (PubChem CID 10526684) has the molecular formula C19H41N7O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[4-(3-aminopropylamino)butyl]-N'-[6-(diaminomethylideneamino)hexyl]-2,2-bis(hydroxymethyl)propanediamide.
| Compound Name | N-[4-(3-aminopropylamino)butyl]-N'-[6-(diaminomethylideneamino)hexyl]-2,2-bis(hydroxymethyl)propanediamide |
|---|---|
| PubChem CID | 10526684 |
| Molecular Formula | C19H41N7O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | N-[4-(3-aminopropylamino)butyl]-N'-[6-(diaminomethylideneamino)hexyl]-2,2-bis(hydroxymethyl)propanediamide |
| SMILES | NCCCNCCCCNC(=O)C(CO)(CO)C(=O)NCCCCCCN=C(N)N |
| InChI | InChI=1S/C19H41N7O4/c20-8-7-10-23-9-5-6-12-25-17(30)19(14-27,15-28)16(29)24-11-3-1-2-4-13-26-18(21)22/h23,27-28H,1-15,20H2,(H,24,29)(H,25,30)(H4,21,22,26) |
| InChIKey | FTPHPQMTHUIEGL-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 201.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|