C19H41N7O4 — CID 15170094
N-[2-[4-(3-aminopropylamino)butylamino]-1-(2-hydroxyethoxy)-2-oxoethyl]-7-(diaminomethylideneamino)heptanamide (PubChem CID 15170094) has the molecular formula C19H41N7O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[2-[4-(3-aminopropylamino)butylamino]-1-(2-hydroxyethoxy)-2-oxoethyl]-7-(diaminomethylideneamino)heptanamide.
| Compound Name | N-[2-[4-(3-aminopropylamino)butylamino]-1-(2-hydroxyethoxy)-2-oxoethyl]-7-(diaminomethylideneamino)heptanamide |
|---|---|
| PubChem CID | 15170094 |
| Molecular Formula | C19H41N7O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | N-[2-[4-(3-aminopropylamino)butylamino]-1-(2-hydroxyethoxy)-2-oxoethyl]-7-(diaminomethylideneamino)heptanamide |
| SMILES | NCCCNCCCCNC(=O)C(NC(=O)CCCCCCN=C(N)N)OCCO |
| InChI | InChI=1S/C19H41N7O4/c20-9-7-11-23-10-5-6-12-24-17(29)18(30-15-14-27)26-16(28)8-3-1-2-4-13-25-19(21)22/h18,23,27H,1-15,20H2,(H,24,29)(H,26,28)(H4,21,22,25) |
| InChIKey | WUQIDKRYTOAWSP-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|