C19H39N5O3 — CID 159753811
N-(8-aminooctyl)-10-(diaminomethylideneamino)-2-hydroxy-4-oxodecanamide (PubChem CID 159753811) has the molecular formula C19H39N5O3 and a molecular weight of 385.55 g/mol. Its IUPAC name is N-(8-aminooctyl)-10-(diaminomethylideneamino)-2-hydroxy-4-oxodecanamide.
| Compound Name | N-(8-aminooctyl)-10-(diaminomethylideneamino)-2-hydroxy-4-oxodecanamide |
|---|---|
| PubChem CID | 159753811 |
| Molecular Formula | C19H39N5O3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.31 |
| IUPAC Name | N-(8-aminooctyl)-10-(diaminomethylideneamino)-2-hydroxy-4-oxodecanamide |
| SMILES | NCCCCCCCCNC(=O)C(O)CC(=O)CCCCCCN=C(N)N |
| InChI | InChI=1S/C19H39N5O3/c20-12-8-4-1-2-5-9-13-23-18(27)17(26)15-16(25)11-7-3-6-10-14-24-19(21)22/h17,26H,1-15,20H2,(H,23,27)(H4,21,22,24) |
| InChIKey | NDZLHCGAIHCKPX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|