C14H30N6O3 — CID 90152029
7-(diaminomethylideneamino)-N-[1-hydroxy-2-[3-(methylamino)propylamino]-2-oxoethyl]heptanamide (PubChem CID 90152029) has the molecular formula C14H30N6O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 7-(diaminomethylideneamino)-N-[1-hydroxy-2-[3-(methylamino)propylamino]-2-oxoethyl]heptanamide.
| Compound Name | 7-(diaminomethylideneamino)-N-[1-hydroxy-2-[3-(methylamino)propylamino]-2-oxoethyl]heptanamide |
|---|---|
| PubChem CID | 90152029 |
| Molecular Formula | C14H30N6O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 7-(diaminomethylideneamino)-N-[1-hydroxy-2-[3-(methylamino)propylamino]-2-oxoethyl]heptanamide |
| SMILES | CNCCCNC(=O)C(O)NC(=O)CCCCCCN=C(N)N |
| InChI | InChI=1S/C14H30N6O3/c1-17-8-6-10-18-12(22)13(23)20-11(21)7-4-2-3-5-9-19-14(15)16/h13,17,23H,2-10H2,1H3,(H,18,22)(H,20,21)(H4,15,16,19) |
| InChIKey | ZQOGKHMYPPKMGU-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|