C25H54N8O2 — CID 162842198
9-(diaminomethylideneamino)-N-[(4S,5R)-13-(diaminomethylideneamino)-5-hydroxy-1-(methylamino)tridecan-4-yl]nonanamide (PubChem CID 162842198) has the molecular formula C25H54N8O2 and a molecular weight of 498.76 g/mol. Its IUPAC name is 9-(diaminomethylideneamino)-N-[(4S,5R)-13-(diaminomethylideneamino)-5-hydroxy-1-(methylamino)tridecan-4-yl]nonanamide.
| Compound Name | 9-(diaminomethylideneamino)-N-[(4S,5R)-13-(diaminomethylideneamino)-5-hydroxy-1-(methylamino)tridecan-4-yl]nonanamide |
|---|---|
| PubChem CID | 162842198 |
| Molecular Formula | C25H54N8O2 |
| Molecular Weight | 498.76 g/mol |
| Exact Mass | 498.44 |
| IUPAC Name | 9-(diaminomethylideneamino)-N-[(4S,5R)-13-(diaminomethylideneamino)-5-hydroxy-1-(methylamino)tridecan-4-yl]nonanamide |
| SMILES | CNCCC[C@H](NC(=O)CCCCCCCCN=C(N)N)[C@H](O)CCCCCCCCN=C(N)N |
| InChI | InChI=1S/C25H54N8O2/c1-30-18-14-15-21(22(34)16-10-6-2-4-8-12-19-31-24(26)27)33-23(35)17-11-7-3-5-9-13-20-32-25(28)29/h21-22,30,34H,2-20H2,1H3,(H,33,35)(H4,26,27,31)(H4,28,29,32)/t21-,22+/m0/s1 |
| InChIKey | FGJXIYSNYJVXGB-FCHUYYIVSA-N |
| XLogP | 1.84 |
| TPSA | 190.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.76 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|