C15H33N7O — CID 170367414
6-[[N'-[6-(diaminomethylideneamino)hexyl]carbamimidoyl]amino]heptanamide (PubChem CID 170367414) has the molecular formula C15H33N7O and a molecular weight of 327.48 g/mol. Its IUPAC name is 6-[[N'-[6-(diaminomethylideneamino)hexyl]carbamimidoyl]amino]heptanamide.
| Compound Name | 6-[[N'-[6-(diaminomethylideneamino)hexyl]carbamimidoyl]amino]heptanamide |
|---|---|
| PubChem CID | 170367414 |
| Molecular Formula | C15H33N7O |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | 6-[[N'-[6-(diaminomethylideneamino)hexyl]carbamimidoyl]amino]heptanamide |
| SMILES | CC(CCCCC(N)=O)N/C(N)=N/CCCCCCN=C(N)N |
| InChI | InChI=1S/C15H33N7O/c1-12(8-4-5-9-13(16)23)22-15(19)21-11-7-3-2-6-10-20-14(17)18/h12H,2-11H2,1H3,(H2,16,23)(H4,17,18,20)(H3,19,21,22) |
| InChIKey | ZGXAZYAPOSVGPN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 157.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|