C24H50N4O — CID 139836172
5-(diaminomethylideneamino)-N-(2-octyldecyl)pentanamide (PubChem CID 139836172) has the molecular formula C24H50N4O and a molecular weight of 410.69 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-N-(2-octyldecyl)pentanamide.
| Compound Name | 5-(diaminomethylideneamino)-N-(2-octyldecyl)pentanamide |
|---|---|
| PubChem CID | 139836172 |
| Molecular Formula | C24H50N4O |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.40 |
| IUPAC Name | 5-(diaminomethylideneamino)-N-(2-octyldecyl)pentanamide |
| SMILES | CCCCCCCCC(CCCCCCCC)CNC(=O)CCCCN=C(N)N |
| InChI | InChI=1S/C24H50N4O/c1-3-5-7-9-11-13-17-22(18-14-12-10-8-6-4-2)21-28-23(29)19-15-16-20-27-24(25)26/h22H,3-21H2,1-2H3,(H,28,29)(H4,25,26,27) |
| InChIKey | QMWJCEBMIIVSOQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|