C16H35N5O — CID 11266997
N-[3-[3-(diaminomethylideneamino)propylamino]propyl]nonanamide (PubChem CID 11266997) has the molecular formula C16H35N5O and a molecular weight of 313.49 g/mol. Its IUPAC name is N-[3-[3-(diaminomethylideneamino)propylamino]propyl]nonanamide.
| Compound Name | N-[3-[3-(diaminomethylideneamino)propylamino]propyl]nonanamide |
|---|---|
| PubChem CID | 11266997 |
| Molecular Formula | C16H35N5O |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | N-[3-[3-(diaminomethylideneamino)propylamino]propyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCCCNCCCN=C(N)N |
| InChI | InChI=1S/C16H35N5O/c1-2-3-4-5-6-7-10-15(22)20-13-8-11-19-12-9-14-21-16(17)18/h19H,2-14H2,1H3,(H,20,22)(H4,17,18,21) |
| InChIKey | AOCUGNDVRWWPTI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|