C33H66N8O4 — CID 11354179
N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(octanoylamino)propyl]butanediamide (PubChem CID 11354179) has the molecular formula C33H66N8O4 and a molecular weight of 638.94 g/mol. Its IUPAC name is N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(octanoylamino)propyl]butanediamide.
| Compound Name | N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(octanoylamino)propyl]butanediamide |
|---|---|
| PubChem CID | 11354179 |
| Molecular Formula | C33H66N8O4 |
| Molecular Weight | 638.94 g/mol |
| Exact Mass | 638.52 |
| IUPAC Name | N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(octanoylamino)propyl]butanediamide |
| SMILES | CCCCCCCC(=O)NCCCN(CCCNC(=O)CCCCCCC)C(=O)CCC(=O)NCCCNCCCN=C(N)N |
| InChI | InChI=1S/C33H66N8O4/c1-3-5-7-9-11-17-29(42)38-25-15-27-41(28-16-26-39-30(43)18-12-10-8-6-4-2)32(45)20-19-31(44)37-23-13-21-36-22-14-24-40-33(34)35/h36H,3-28H2,1-2H3,(H,37,44)(H,38,42)(H,39,43)(H4,34,35,40) |
| InChIKey | ONYUVLSQIKLVAB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.94 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|