C31H62N8O4 — CID 11467613
N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(5-methylhexanoylamino)propyl]butanediamide (PubChem CID 11467613) has the molecular formula C31H62N8O4 and a molecular weight of 610.89 g/mol. Its IUPAC name is N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(5-methylhexanoylamino)propyl]butanediamide.
| Compound Name | N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(5-methylhexanoylamino)propyl]butanediamide |
|---|---|
| PubChem CID | 11467613 |
| Molecular Formula | C31H62N8O4 |
| Molecular Weight | 610.89 g/mol |
| Exact Mass | 610.49 |
| IUPAC Name | N-[3-[3-(diaminomethylideneamino)propylamino]propyl]-N',N'-bis[3-(5-methylhexanoylamino)propyl]butanediamide |
| SMILES | CC(C)CCCC(=O)NCCCN(CCCNC(=O)CCCC(C)C)C(=O)CCC(=O)NCCCNCCCN=C(N)N |
| InChI | InChI=1S/C31H62N8O4/c1-25(2)11-5-13-27(40)36-21-9-23-39(24-10-22-37-28(41)14-6-12-26(3)4)30(43)16-15-29(42)35-19-7-17-34-18-8-20-38-31(32)33/h25-26,34H,5-24H2,1-4H3,(H,35,42)(H,36,40)(H,37,41)(H4,32,33,38) |
| InChIKey | GLSWHITXSMIUST-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.89 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|