C17H36N2O2 — CID 169103058
N-butyl-N'-methyl-N'-(4-methylpentyl)butanediamide;ethane (PubChem CID 169103058) has the molecular formula C17H36N2O2 and a molecular weight of 300.49 g/mol. Its IUPAC name is N-butyl-N'-methyl-N'-(4-methylpentyl)butanediamide;ethane.
| Compound Name | N-butyl-N'-methyl-N'-(4-methylpentyl)butanediamide;ethane |
|---|---|
| PubChem CID | 169103058 |
| Molecular Formula | C17H36N2O2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | N-butyl-N'-methyl-N'-(4-methylpentyl)butanediamide;ethane |
| SMILES | CC.CCCCNC(=O)CCC(=O)N(C)CCCC(C)C |
| InChI | InChI=1S/C15H30N2O2.C2H6/c1-5-6-11-16-14(18)9-10-15(19)17(4)12-7-8-13(2)3;1-2/h13H,5-12H2,1-4H3,(H,16,18);1-2H3 |
| InChIKey | GIBJGBLXLTZMAT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|